About 2-chloro-7-[1-(2,2-difluoroethyl)pyrazol-4-yl]-1,5-naphthyridine
2-chloro-7-[1-(2,2-difluoroethyl)pyrazol-4-yl]-1,5-naphthyridine (PubChem CID 90288882) has the molecular formula C13H9ClF2N4
and a molecular weight of 294.69 g/mol. Its IUPAC name is 2-chloro-7-[1-(2,2-difluoroethyl)pyrazol-4-yl]-1,5-naphthyridine.
Molecular Properties
| Compound Name | 2-chloro-7-[1-(2,2-difluoroethyl)pyrazol-4-yl]-1,5-naphthyridine |
| PubChem CID | 90288882 |
| Molecular Formula | C13H9ClF2N4 |
| Molecular Weight | 294.69 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | 2-chloro-7-[1-(2,2-difluoroethyl)pyrazol-4-yl]-1,5-naphthyridine |
| SMILES | FC(F)Cn1cc(-c2cnc3ccc(Cl)nc3c2)cn1 |
| InChI | InChI=1S/C13H9ClF2N4/c14-12-2-1-10-11(19-12)3-8(4-17-10)9-5-18-20(6-9)7-13(15)16/h1-6,13H,7H2 |
| InChIKey | RKSDSNWFJQOFPY-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.69 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-7-[1-(2,2-difluoroethyl)pyrazol-4-yl]-1,5-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-7-[1-(2,2-difluoroethyl)pyrazol-4-yl]-1,5-naphthyridine?
The IUPAC name of 2-chloro-7-[1-(2,2-difluoroethyl)pyrazol-4-yl]-1,5-naphthyridine (CID 90288882) is 2-chloro-7-[1-(2,2-difluoroethyl)pyrazol-4-yl]-1,5-naphthyridine.
What is the SMILES notation for 2-chloro-7-[1-(2,2-difluoroethyl)pyrazol-4-yl]-1,5-naphthyridine?
The canonical SMILES for 2-chloro-7-[1-(2,2-difluoroethyl)pyrazol-4-yl]-1,5-naphthyridine is FC(F)Cn1cc(-c2cnc3ccc(Cl)nc3c2)cn1.
What is the InChIKey of 2-chloro-7-[1-(2,2-difluoroethyl)pyrazol-4-yl]-1,5-naphthyridine?
The InChIKey is RKSDSNWFJQOFPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9ClF2N4/c14-12-2-1-10-11(19-12)3-8(4-17-10)9-5-18-20(6-9)7-13(15)16/h1-6,13H,7H2.
What are the key properties of 2-chloro-7-[1-(2,2-difluoroethyl)pyrazol-4-yl]-1,5-naphthyridine?
2-chloro-7-[1-(2,2-difluoroethyl)pyrazol-4-yl]-1,5-naphthyridine has a molecular weight of 294.69 g/mol, XLogP of 3.41, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-7-[1-(2,2-difluoroethyl)pyrazol-4-yl]-1,5-naphthyridine is sourced from PubChem (CID 90288882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).