About 5-(cyclohexylmethyl)-1,2-dihydropyridazin-3-amine
5-(cyclohexylmethyl)-1,2-dihydropyridazin-3-amine (PubChem CID 90289170) has the molecular formula C11H19N3
and a molecular weight of 193.29 g/mol. Its IUPAC name is 5-(cyclohexylmethyl)-1,2-dihydropyridazin-3-amine.
Molecular Properties
| Compound Name | 5-(cyclohexylmethyl)-1,2-dihydropyridazin-3-amine |
| PubChem CID | 90289170 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | 5-(cyclohexylmethyl)-1,2-dihydropyridazin-3-amine |
| SMILES | NC1=CC(CC2CCCCC2)=CNN1 |
| InChI | InChI=1S/C11H19N3/c12-11-7-10(8-13-14-11)6-9-4-2-1-3-5-9/h7-9,13-14H,1-6,12H2 |
| InChIKey | NSWCIIHLYUWWCK-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(cyclohexylmethyl)-1,2-dihydropyridazin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(cyclohexylmethyl)-1,2-dihydropyridazin-3-amine?
The IUPAC name of 5-(cyclohexylmethyl)-1,2-dihydropyridazin-3-amine (CID 90289170) is 5-(cyclohexylmethyl)-1,2-dihydropyridazin-3-amine.
What is the SMILES notation for 5-(cyclohexylmethyl)-1,2-dihydropyridazin-3-amine?
The canonical SMILES for 5-(cyclohexylmethyl)-1,2-dihydropyridazin-3-amine is NC1=CC(CC2CCCCC2)=CNN1.
What is the InChIKey of 5-(cyclohexylmethyl)-1,2-dihydropyridazin-3-amine?
The InChIKey is NSWCIIHLYUWWCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3/c12-11-7-10(8-13-14-11)6-9-4-2-1-3-5-9/h7-9,13-14H,1-6,12H2.
What are the key properties of 5-(cyclohexylmethyl)-1,2-dihydropyridazin-3-amine?
5-(cyclohexylmethyl)-1,2-dihydropyridazin-3-amine has a molecular weight of 193.29 g/mol, XLogP of 1.75, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(cyclohexylmethyl)-1,2-dihydropyridazin-3-amine is sourced from PubChem (CID 90289170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).