About 7-(1,3-dimethylpyrazol-4-yl)-N-(5-prop-1-en-2-ylpyridazin-3-yl)-1,5-naphthyridin-2-amine
7-(1,3-dimethylpyrazol-4-yl)-N-(5-prop-1-en-2-ylpyridazin-3-yl)-1,5-naphthyridin-2-amine (PubChem CID 90289380) has the molecular formula C20H19N7
and a molecular weight of 357.42 g/mol. Its IUPAC name is 7-(1,3-dimethylpyrazol-4-yl)-N-(5-prop-1-en-2-ylpyridazin-3-yl)-1,5-naphthyridin-2-amine.
Molecular Properties
| Compound Name | 7-(1,3-dimethylpyrazol-4-yl)-N-(5-prop-1-en-2-ylpyridazin-3-yl)-1,5-naphthyridin-2-amine |
| PubChem CID | 90289380 |
| Molecular Formula | C20H19N7 |
| Molecular Weight | 357.42 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 7-(1,3-dimethylpyrazol-4-yl)-N-(5-prop-1-en-2-ylpyridazin-3-yl)-1,5-naphthyridin-2-amine |
| SMILES | C=C(C)c1cnnc(Nc2ccc3ncc(-c4cn(C)nc4C)cc3n2)c1 |
| InChI | InChI=1S/C20H19N7/c1-12(2)14-8-20(25-22-10-14)24-19-6-5-17-18(23-19)7-15(9-21-17)16-11-27(4)26-13(16)3/h5-11H,1H2,2-4H3,(H,23,24,25) |
| InChIKey | ZRAWPFBKBBAXTL-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 81.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.42 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 7-(1,3-dimethylpyrazol-4-yl)-N-(5-prop-1-en-2-ylpyridazin-3-yl)-1,5-naphthyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(1,3-dimethylpyrazol-4-yl)-N-(5-prop-1-en-2-ylpyridazin-3-yl)-1,5-naphthyridin-2-amine?
The IUPAC name of 7-(1,3-dimethylpyrazol-4-yl)-N-(5-prop-1-en-2-ylpyridazin-3-yl)-1,5-naphthyridin-2-amine (CID 90289380) is 7-(1,3-dimethylpyrazol-4-yl)-N-(5-prop-1-en-2-ylpyridazin-3-yl)-1,5-naphthyridin-2-amine.
What is the SMILES notation for 7-(1,3-dimethylpyrazol-4-yl)-N-(5-prop-1-en-2-ylpyridazin-3-yl)-1,5-naphthyridin-2-amine?
The canonical SMILES for 7-(1,3-dimethylpyrazol-4-yl)-N-(5-prop-1-en-2-ylpyridazin-3-yl)-1,5-naphthyridin-2-amine is C=C(C)c1cnnc(Nc2ccc3ncc(-c4cn(C)nc4C)cc3n2)c1.
What is the InChIKey of 7-(1,3-dimethylpyrazol-4-yl)-N-(5-prop-1-en-2-ylpyridazin-3-yl)-1,5-naphthyridin-2-amine?
The InChIKey is ZRAWPFBKBBAXTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19N7/c1-12(2)14-8-20(25-22-10-14)24-19-6-5-17-18(23-19)7-15(9-21-17)16-11-27(4)26-13(16)3/h5-11H,1H2,2-4H3,(H,23,24,25).
What are the key properties of 7-(1,3-dimethylpyrazol-4-yl)-N-(5-prop-1-en-2-ylpyridazin-3-yl)-1,5-naphthyridin-2-amine?
7-(1,3-dimethylpyrazol-4-yl)-N-(5-prop-1-en-2-ylpyridazin-3-yl)-1,5-naphthyridin-2-amine has a molecular weight of 357.42 g/mol, XLogP of 3.91, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(1,3-dimethylpyrazol-4-yl)-N-(5-prop-1-en-2-ylpyridazin-3-yl)-1,5-naphthyridin-2-amine is sourced from PubChem (CID 90289380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).