C22H29BN4O2 — CID 90289545
N-(1-methyl-4-propan-2-ylpyrrol-2-yl)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,5-naphthyridin-2-amine (PubChem CID 90289545) has the molecular formula C22H29BN4O2 and a molecular weight of 392.31 g/mol. Its IUPAC name is N-(1-methyl-4-propan-2-ylpyrrol-2-yl)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,5-naphthyridin-2-amine.
| Compound Name | N-(1-methyl-4-propan-2-ylpyrrol-2-yl)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,5-naphthyridin-2-amine |
|---|---|
| PubChem CID | 90289545 |
| Molecular Formula | C22H29BN4O2 |
| Molecular Weight | 392.31 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | N-(1-methyl-4-propan-2-ylpyrrol-2-yl)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,5-naphthyridin-2-amine |
| SMILES | CC(C)c1cc(Nc2ccc3ncc(B4OC(C)(C)C(C)(C)O4)cc3n2)n(C)c1 |
| InChI | InChI=1S/C22H29BN4O2/c1-14(2)15-10-20(27(7)13-15)26-19-9-8-17-18(25-19)11-16(12-24-17)23-28-21(3,4)22(5,6)29-23/h8-14H,1-7H3,(H,25,26) |
| InChIKey | RDWPBCQMXZNUFV-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 61.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.31 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|