C36H30I2N2O12 — CID 90289804
2-(3,4-dihydroxyphenyl)-8-[[2-[[2-(3,4-diiodophenyl)-3,5,7-trihydroxy-4-oxochromen-8-yl]methyl-methylamino]ethyl-methylamino]methyl]-3,5,7-trihydroxychromen-4-one (PubChem CID 90289804) has the molecular formula C36H30I2N2O12 and a molecular weight of 936.45 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)-8-[[2-[[2-(3,4-diiodophenyl)-3,5,7-trihydroxy-4-oxochromen-8-yl]methyl-methylamino]ethyl-methylamino]methyl]-3,5,7-trihydroxychromen-4-one.
| Compound Name | 2-(3,4-dihydroxyphenyl)-8-[[2-[[2-(3,4-diiodophenyl)-3,5,7-trihydroxy-4-oxochromen-8-yl]methyl-methylamino]ethyl-methylamino]methyl]-3,5,7-trihydroxychromen-4-one |
|---|---|
| PubChem CID | 90289804 |
| Molecular Formula | C36H30I2N2O12 |
| Molecular Weight | 936.45 g/mol |
| Exact Mass | 935.99 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-8-[[2-[[2-(3,4-diiodophenyl)-3,5,7-trihydroxy-4-oxochromen-8-yl]methyl-methylamino]ethyl-methylamino]methyl]-3,5,7-trihydroxychromen-4-one |
| SMILES | CN(CCN(C)Cc1c(O)cc(O)c2c(=O)c(O)c(-c3ccc(I)c(I)c3)oc12)Cc1c(O)cc(O)c2c(=O)c(O)c(-c3ccc(O)c(O)c3)oc12 |
| InChI | InChI=1S/C36H30I2N2O12/c1-39(13-17-22(42)11-25(45)27-29(47)31(49)33(51-35(17)27)15-3-5-19(37)20(38)9-15)7-8-40(2)14-18-23(43)12-26(46)28-30(48)32(50)34(52-36(18)28)16-4-6-21(41)24(44)10-16/h3-6,9-12,41-46,49-50H,7-8,13-14H2,1-2H3 |
| InChIKey | UDZSAHGDFKMPLG-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 228.74 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 936.45 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|