C31H47NOSi — CID 90290066
(2R,3S,4S,4aR)-4-[3-[hydroxy(diphenyl)silyl]-3-methylbutyl]-3,4a,8,8-tetramethyl-1,2,3,4,5,6,7,8a-octahydronaphthalen-2-amine (PubChem CID 90290066) has the molecular formula C31H47NOSi and a molecular weight of 477.81 g/mol. Its IUPAC name is (2R,3S,4S,4aR)-4-[3-[hydroxy(diphenyl)silyl]-3-methylbutyl]-3,4a,8,8-tetramethyl-1,2,3,4,5,6,7,8a-octahydronaphthalen-2-amine.
| Compound Name | (2R,3S,4S,4aR)-4-[3-[hydroxy(diphenyl)silyl]-3-methylbutyl]-3,4a,8,8-tetramethyl-1,2,3,4,5,6,7,8a-octahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 90290066 |
| Molecular Formula | C31H47NOSi |
| Molecular Weight | 477.81 g/mol |
| Exact Mass | 477.34 |
| IUPAC Name | (2R,3S,4S,4aR)-4-[3-[hydroxy(diphenyl)silyl]-3-methylbutyl]-3,4a,8,8-tetramethyl-1,2,3,4,5,6,7,8a-octahydronaphthalen-2-amine |
| SMILES | C[C@@H]1[C@H](N)CC2C(C)(C)CCC[C@]2(C)[C@H]1CCC(C)(C)[Si](O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H47NOSi/c1-23-26(31(6)20-13-19-29(2,3)28(31)22-27(23)32)18-21-30(4,5)34(33,24-14-9-7-10-15-24)25-16-11-8-12-17-25/h7-12,14-17,23,26-28,33H,13,18-22,32H2,1-6H3/t23-,26-,27+,28?,31+/m0/s1 |
| InChIKey | QWUBFZDDOAXVOX-KBVZXLLLSA-N |
| XLogP | 6.11 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.81 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|