C22H28ClN3O3 — CID 90290080
9-butoxy-6-[(4-chloro-2-methylphenyl)methyl]-2-propan-2-yl-3,4-dihydropyrazino[1,2-c]pyrimidine-1,8-dione (PubChem CID 90290080) has the molecular formula C22H28ClN3O3 and a molecular weight of 417.94 g/mol. Its IUPAC name is 9-butoxy-6-[(4-chloro-2-methylphenyl)methyl]-2-propan-2-yl-3,4-dihydropyrazino[1,2-c]pyrimidine-1,8-dione.
| Compound Name | 9-butoxy-6-[(4-chloro-2-methylphenyl)methyl]-2-propan-2-yl-3,4-dihydropyrazino[1,2-c]pyrimidine-1,8-dione |
|---|---|
| PubChem CID | 90290080 |
| Molecular Formula | C22H28ClN3O3 |
| Molecular Weight | 417.94 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | 9-butoxy-6-[(4-chloro-2-methylphenyl)methyl]-2-propan-2-yl-3,4-dihydropyrazino[1,2-c]pyrimidine-1,8-dione |
| SMILES | CCCCOc1c2n(c(Cc3ccc(Cl)cc3C)nc1=O)CCN(C(C)C)C2=O |
| InChI | InChI=1S/C22H28ClN3O3/c1-5-6-11-29-20-19-22(28)25(14(2)3)9-10-26(19)18(24-21(20)27)13-16-7-8-17(23)12-15(16)4/h7-8,12,14H,5-6,9-11,13H2,1-4H3 |
| InChIKey | IMQJMBIKAHQTJY-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.94 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|