C42H28N6O2 — CID 90290126
2-[4-[2,9-dimethyl-7-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]-1,10-phenanthrolin-4-yl]phenyl]-5-phenyl-1,3,4-oxadiazole (PubChem CID 90290126) has the molecular formula C42H28N6O2 and a molecular weight of 648.73 g/mol. Its IUPAC name is 2-[4-[2,9-dimethyl-7-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]-1,10-phenanthrolin-4-yl]phenyl]-5-phenyl-1,3,4-oxadiazole.
| Compound Name | 2-[4-[2,9-dimethyl-7-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]-1,10-phenanthrolin-4-yl]phenyl]-5-phenyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 90290126 |
| Molecular Formula | C42H28N6O2 |
| Molecular Weight | 648.73 g/mol |
| Exact Mass | 648.23 |
| IUPAC Name | 2-[4-[2,9-dimethyl-7-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]-1,10-phenanthrolin-4-yl]phenyl]-5-phenyl-1,3,4-oxadiazole |
| SMILES | Cc1cc(-c2ccc(-c3nnc(-c4ccccc4)o3)cc2)c2ccc3c(-c4ccc(-c5nnc(-c6ccccc6)o5)cc4)cc(C)nc3c2n1 |
| InChI | InChI=1S/C42H28N6O2/c1-25-23-35(27-13-17-31(18-14-27)41-47-45-39(49-41)29-9-5-3-6-10-29)33-21-22-34-36(24-26(2)44-38(34)37(33)43-25)28-15-19-32(20-16-28)42-48-46-40(50-42)30-11-7-4-8-12-30/h3-24H,1-2H3 |
| InChIKey | JVERMWMSIDZHAU-UHFFFAOYSA-N |
| XLogP | 10.17 |
| TPSA | 103.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.73 |
| LogP ≤ 5 | 10.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|