C14H12N2O — CID 90290134
4,7-dimethyl-1a,9b-dihydrooxireno[2,3-f][1,10]phenanthroline (PubChem CID 90290134) has the molecular formula C14H12N2O and a molecular weight of 224.26 g/mol. Its IUPAC name is 4,7-dimethyl-1a,9b-dihydrooxireno[2,3-f][1,10]phenanthroline.
| Compound Name | 4,7-dimethyl-1a,9b-dihydrooxireno[2,3-f][1,10]phenanthroline |
|---|---|
| PubChem CID | 90290134 |
| Molecular Formula | C14H12N2O |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | 4,7-dimethyl-1a,9b-dihydrooxireno[2,3-f][1,10]phenanthroline |
| SMILES | Cc1ccc2c(n1)-c1nc(C)ccc1C1OC21 |
| InChI | InChI=1S/C14H12N2O/c1-7-3-5-9-11(15-7)12-10(14-13(9)17-14)6-4-8(2)16-12/h3-6,13-14H,1-2H3 |
| InChIKey | MVMBVAMZEREMKS-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 38.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|