C29H30F3N3O4 — CID 90290205
N,N-dimethyl-4-[(E)-2-[6-[2-[2-[[3-(trifluoromethoxy)phenyl]methylamino]ethoxy]ethoxy]-1,3-benzoxazol-2-yl]ethenyl]aniline (PubChem CID 90290205) has the molecular formula C29H30F3N3O4 and a molecular weight of 541.57 g/mol. Its IUPAC name is N,N-dimethyl-4-[(E)-2-[6-[2-[2-[[3-(trifluoromethoxy)phenyl]methylamino]ethoxy]ethoxy]-1,3-benzoxazol-2-yl]ethenyl]aniline.
| Compound Name | N,N-dimethyl-4-[(E)-2-[6-[2-[2-[[3-(trifluoromethoxy)phenyl]methylamino]ethoxy]ethoxy]-1,3-benzoxazol-2-yl]ethenyl]aniline |
|---|---|
| PubChem CID | 90290205 |
| Molecular Formula | C29H30F3N3O4 |
| Molecular Weight | 541.57 g/mol |
| Exact Mass | 541.22 |
| IUPAC Name | N,N-dimethyl-4-[(E)-2-[6-[2-[2-[[3-(trifluoromethoxy)phenyl]methylamino]ethoxy]ethoxy]-1,3-benzoxazol-2-yl]ethenyl]aniline |
| SMILES | CN(C)c1ccc(/C=C/c2nc3ccc(OCCOCCNCc4cccc(OC(F)(F)F)c4)cc3o2)cc1 |
| InChI | InChI=1S/C29H30F3N3O4/c1-35(2)23-9-6-21(7-10-23)8-13-28-34-26-12-11-24(19-27(26)38-28)37-17-16-36-15-14-33-20-22-4-3-5-25(18-22)39-29(30,31)32/h3-13,18-19,33H,14-17,20H2,1-2H3/b13-8+ |
| InChIKey | YWVXWWLOMRKPTA-MDWZMJQESA-N |
| XLogP | 6.15 |
| TPSA | 68.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.57 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|