C29H24N6O — CID 90291011
4-amino-2-[[(1S)-1-[5-(2-methyl-4-pyridinyl)-4-oxo-3-phenylquinazolin-2-yl]ethyl]amino]benzonitrile (PubChem CID 90291011) has the molecular formula C29H24N6O and a molecular weight of 472.55 g/mol. Its IUPAC name is 4-amino-2-[[(1S)-1-[5-(2-methyl-4-pyridinyl)-4-oxo-3-phenylquinazolin-2-yl]ethyl]amino]benzonitrile.
| Compound Name | 4-amino-2-[[(1S)-1-[5-(2-methyl-4-pyridinyl)-4-oxo-3-phenylquinazolin-2-yl]ethyl]amino]benzonitrile |
|---|---|
| PubChem CID | 90291011 |
| Molecular Formula | C29H24N6O |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | 4-amino-2-[[(1S)-1-[5-(2-methyl-4-pyridinyl)-4-oxo-3-phenylquinazolin-2-yl]ethyl]amino]benzonitrile |
| SMILES | Cc1cc(-c2cccc3nc([C@H](C)Nc4cc(N)ccc4C#N)n(-c4ccccc4)c(=O)c23)ccn1 |
| InChI | InChI=1S/C29H24N6O/c1-18-15-20(13-14-32-18)24-9-6-10-25-27(24)29(36)35(23-7-4-3-5-8-23)28(34-25)19(2)33-26-16-22(31)12-11-21(26)17-30/h3-16,19,33H,31H2,1-2H3/t19-/m0/s1 |
| InChIKey | HHKKCYSCFXHKMT-IBGZPJMESA-N |
| XLogP | 5.38 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|