C25H30N6O4Si — CID 90291022
5-[5-methyl-2-(pyridin-4-ylmethylcarbamoyl)-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]-1H-pyrrolo[3,2-b]pyridine-2-carboxylic acid (PubChem CID 90291022) has the molecular formula C25H30N6O4Si and a molecular weight of 506.64 g/mol. Its IUPAC name is 5-[5-methyl-2-(pyridin-4-ylmethylcarbamoyl)-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]-1H-pyrrolo[3,2-b]pyridine-2-carboxylic acid.
| Compound Name | 5-[5-methyl-2-(pyridin-4-ylmethylcarbamoyl)-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]-1H-pyrrolo[3,2-b]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 90291022 |
| Molecular Formula | C25H30N6O4Si |
| Molecular Weight | 506.64 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | 5-[5-methyl-2-(pyridin-4-ylmethylcarbamoyl)-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]-1H-pyrrolo[3,2-b]pyridine-2-carboxylic acid |
| SMILES | Cc1c(-c2ccc3[nH]c(C(=O)O)cc3n2)nc(C(=O)NCc2ccncc2)n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C25H30N6O4Si/c1-16-22(19-6-5-18-20(29-19)13-21(28-18)25(33)34)30-23(31(16)15-35-11-12-36(2,3)4)24(32)27-14-17-7-9-26-10-8-17/h5-10,13,28H,11-12,14-15H2,1-4H3,(H,27,32)(H,33,34) |
| InChIKey | JJNRUWSEHPLANH-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 135.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.64 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|