C12H19ClN2 — CID 90291323
(3Z,4Z)-6-chloro-N,N-dimethyl-3-[1-(methylideneamino)ethylidene]hepta-1,4-dien-2-amine (PubChem CID 90291323) has the molecular formula C12H19ClN2 and a molecular weight of 226.75 g/mol. Its IUPAC name is (3Z,4Z)-6-chloro-N,N-dimethyl-3-[1-(methylideneamino)ethylidene]hepta-1,4-dien-2-amine.
| Compound Name | (3Z,4Z)-6-chloro-N,N-dimethyl-3-[1-(methylideneamino)ethylidene]hepta-1,4-dien-2-amine |
|---|---|
| PubChem CID | 90291323 |
| Molecular Formula | C12H19ClN2 |
| Molecular Weight | 226.75 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | (3Z,4Z)-6-chloro-N,N-dimethyl-3-[1-(methylideneamino)ethylidene]hepta-1,4-dien-2-amine |
| SMILES | C=N/C(C)=C(/C=C\C(C)Cl)C(=C)N(C)C |
| InChI | InChI=1S/C12H19ClN2/c1-9(13)7-8-12(10(2)14-4)11(3)15(5)6/h7-9H,3-4H2,1-2,5-6H3/b8-7-,12-10- |
| InChIKey | XFZGCETWUDVIRQ-ZMBXXGKISA-N |
| XLogP | 3.22 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.75 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|