About ethyl 2-(3,3-difluoropiperidin-1-yl)-1,3-oxazole-4-carboxylate
ethyl 2-(3,3-difluoropiperidin-1-yl)-1,3-oxazole-4-carboxylate (PubChem CID 90291471) has the molecular formula C11H14F2N2O3
and a molecular weight of 260.24 g/mol. Its IUPAC name is ethyl 2-(3,3-difluoropiperidin-1-yl)-1,3-oxazole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-(3,3-difluoropiperidin-1-yl)-1,3-oxazole-4-carboxylate |
| PubChem CID | 90291471 |
| Molecular Formula | C11H14F2N2O3 |
| Molecular Weight | 260.24 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | ethyl 2-(3,3-difluoropiperidin-1-yl)-1,3-oxazole-4-carboxylate |
| SMILES | CCOC(=O)c1coc(N2CCCC(F)(F)C2)n1 |
| InChI | InChI=1S/C11H14F2N2O3/c1-2-17-9(16)8-6-18-10(14-8)15-5-3-4-11(12,13)7-15/h6H,2-5,7H2,1H3 |
| InChIKey | PRXJEQVQPXLVON-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.24 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 2-(3,3-difluoropiperidin-1-yl)-1,3-oxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(3,3-difluoropiperidin-1-yl)-1,3-oxazole-4-carboxylate?
The IUPAC name of ethyl 2-(3,3-difluoropiperidin-1-yl)-1,3-oxazole-4-carboxylate (CID 90291471) is ethyl 2-(3,3-difluoropiperidin-1-yl)-1,3-oxazole-4-carboxylate.
What is the SMILES notation for ethyl 2-(3,3-difluoropiperidin-1-yl)-1,3-oxazole-4-carboxylate?
The canonical SMILES for ethyl 2-(3,3-difluoropiperidin-1-yl)-1,3-oxazole-4-carboxylate is CCOC(=O)c1coc(N2CCCC(F)(F)C2)n1.
What is the InChIKey of ethyl 2-(3,3-difluoropiperidin-1-yl)-1,3-oxazole-4-carboxylate?
The InChIKey is PRXJEQVQPXLVON-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14F2N2O3/c1-2-17-9(16)8-6-18-10(14-8)15-5-3-4-11(12,13)7-15/h6H,2-5,7H2,1H3.
What are the key properties of ethyl 2-(3,3-difluoropiperidin-1-yl)-1,3-oxazole-4-carboxylate?
ethyl 2-(3,3-difluoropiperidin-1-yl)-1,3-oxazole-4-carboxylate has a molecular weight of 260.24 g/mol, XLogP of 2.09, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(3,3-difluoropiperidin-1-yl)-1,3-oxazole-4-carboxylate is sourced from PubChem (CID 90291471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).