About [(2S)-2-(2-oxo-1,3-oxazolidin-4-yl)-3-phenylmethoxypropyl] benzoate
[(2S)-2-(2-oxo-1,3-oxazolidin-4-yl)-3-phenylmethoxypropyl] benzoate (PubChem CID 90291631) has the molecular formula C20H21NO5
and a molecular weight of 355.39 g/mol. Its IUPAC name is [(2S)-2-(2-oxo-1,3-oxazolidin-4-yl)-3-phenylmethoxypropyl] benzoate.
Molecular Properties
| Compound Name | [(2S)-2-(2-oxo-1,3-oxazolidin-4-yl)-3-phenylmethoxypropyl] benzoate |
| PubChem CID | 90291631 |
| Molecular Formula | C20H21NO5 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | [(2S)-2-(2-oxo-1,3-oxazolidin-4-yl)-3-phenylmethoxypropyl] benzoate |
| SMILES | O=C1NC([C@@H](COCc2ccccc2)COC(=O)c2ccccc2)CO1 |
| InChI | InChI=1S/C20H21NO5/c22-19(16-9-5-2-6-10-16)25-13-17(18-14-26-20(23)21-18)12-24-11-15-7-3-1-4-8-15/h1-10,17-18H,11-14H2,(H,21,23)/t17-,18?/m0/s1 |
| InChIKey | DIBRODSMCJVPRY-ZENAZSQFSA-N |
| XLogP | 2.78 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(2S)-2-(2-oxo-1,3-oxazolidin-4-yl)-3-phenylmethoxypropyl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-2-(2-oxo-1,3-oxazolidin-4-yl)-3-phenylmethoxypropyl] benzoate?
The IUPAC name of [(2S)-2-(2-oxo-1,3-oxazolidin-4-yl)-3-phenylmethoxypropyl] benzoate (CID 90291631) is [(2S)-2-(2-oxo-1,3-oxazolidin-4-yl)-3-phenylmethoxypropyl] benzoate.
What is the SMILES notation for [(2S)-2-(2-oxo-1,3-oxazolidin-4-yl)-3-phenylmethoxypropyl] benzoate?
The canonical SMILES for [(2S)-2-(2-oxo-1,3-oxazolidin-4-yl)-3-phenylmethoxypropyl] benzoate is O=C1NC([C@@H](COCc2ccccc2)COC(=O)c2ccccc2)CO1.
What is the InChIKey of [(2S)-2-(2-oxo-1,3-oxazolidin-4-yl)-3-phenylmethoxypropyl] benzoate?
The InChIKey is DIBRODSMCJVPRY-ZENAZSQFSA-N. The full InChI is InChI=1S/C20H21NO5/c22-19(16-9-5-2-6-10-16)25-13-17(18-14-26-20(23)21-18)12-24-11-15-7-3-1-4-8-15/h1-10,17-18H,11-14H2,(H,21,23)/t17-,18?/m0/s1.
What are the key properties of [(2S)-2-(2-oxo-1,3-oxazolidin-4-yl)-3-phenylmethoxypropyl] benzoate?
[(2S)-2-(2-oxo-1,3-oxazolidin-4-yl)-3-phenylmethoxypropyl] benzoate has a molecular weight of 355.39 g/mol, XLogP of 2.78, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-2-(2-oxo-1,3-oxazolidin-4-yl)-3-phenylmethoxypropyl] benzoate is sourced from PubChem (CID 90291631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).