About 2-(2,5-dimethylpyrimidin-4-yl)-1,1-diphenylhydrazine
2-(2,5-dimethylpyrimidin-4-yl)-1,1-diphenylhydrazine (PubChem CID 90291760) has the molecular formula C18H18N4
and a molecular weight of 290.37 g/mol. Its IUPAC name is 2-(2,5-dimethylpyrimidin-4-yl)-1,1-diphenylhydrazine.
Molecular Properties
| Compound Name | 2-(2,5-dimethylpyrimidin-4-yl)-1,1-diphenylhydrazine |
| PubChem CID | 90291760 |
| Molecular Formula | C18H18N4 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 2-(2,5-dimethylpyrimidin-4-yl)-1,1-diphenylhydrazine |
| SMILES | Cc1ncc(C)c(NN(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C18H18N4/c1-14-13-19-15(2)20-18(14)21-22(16-9-5-3-6-10-16)17-11-7-4-8-12-17/h3-13H,1-2H3,(H,19,20,21) |
| InChIKey | WFRWAGSIHOMLRU-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,5-dimethylpyrimidin-4-yl)-1,1-diphenylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-dimethylpyrimidin-4-yl)-1,1-diphenylhydrazine?
The IUPAC name of 2-(2,5-dimethylpyrimidin-4-yl)-1,1-diphenylhydrazine (CID 90291760) is 2-(2,5-dimethylpyrimidin-4-yl)-1,1-diphenylhydrazine.
What is the SMILES notation for 2-(2,5-dimethylpyrimidin-4-yl)-1,1-diphenylhydrazine?
The canonical SMILES for 2-(2,5-dimethylpyrimidin-4-yl)-1,1-diphenylhydrazine is Cc1ncc(C)c(NN(c2ccccc2)c2ccccc2)n1.
What is the InChIKey of 2-(2,5-dimethylpyrimidin-4-yl)-1,1-diphenylhydrazine?
The InChIKey is WFRWAGSIHOMLRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N4/c1-14-13-19-15(2)20-18(14)21-22(16-9-5-3-6-10-16)17-11-7-4-8-12-17/h3-13H,1-2H3,(H,19,20,21).
What are the key properties of 2-(2,5-dimethylpyrimidin-4-yl)-1,1-diphenylhydrazine?
2-(2,5-dimethylpyrimidin-4-yl)-1,1-diphenylhydrazine has a molecular weight of 290.37 g/mol, XLogP of 4.26, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dimethylpyrimidin-4-yl)-1,1-diphenylhydrazine is sourced from PubChem (CID 90291760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).