C8H11N3 — CID 90291949
8-methyl-1,4,7,8-tetrahydropyrido[3,4-d]pyrimidine (PubChem CID 90291949) has the molecular formula C8H11N3 and a molecular weight of 149.20 g/mol. Its IUPAC name is 8-methyl-1,4,7,8-tetrahydropyrido[3,4-d]pyrimidine.
| Compound Name | 8-methyl-1,4,7,8-tetrahydropyrido[3,4-d]pyrimidine |
|---|---|
| PubChem CID | 90291949 |
| Molecular Formula | C8H11N3 |
| Molecular Weight | 149.20 g/mol |
| Exact Mass | 149.10 |
| IUPAC Name | 8-methyl-1,4,7,8-tetrahydropyrido[3,4-d]pyrimidine |
| SMILES | CC1NC=CC2=C1NC=NC2 |
| InChI | InChI=1S/C8H11N3/c1-6-8-7(2-3-10-6)4-9-5-11-8/h2-3,5-6,10H,4H2,1H3,(H,9,11) |
| InChIKey | XQUDYENLPZPFTQ-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.20 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |