About 2,4-dimethyl-6-(2,3,5-trimethylphenyl)phenol
2,4-dimethyl-6-(2,3,5-trimethylphenyl)phenol (PubChem CID 90291954) has the molecular formula C17H20O
and a molecular weight of 240.35 g/mol. Its IUPAC name is 2,4-dimethyl-6-(2,3,5-trimethylphenyl)phenol.
Molecular Properties
| Compound Name | 2,4-dimethyl-6-(2,3,5-trimethylphenyl)phenol |
| PubChem CID | 90291954 |
| Molecular Formula | C17H20O |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | 2,4-dimethyl-6-(2,3,5-trimethylphenyl)phenol |
| SMILES | Cc1cc(C)c(C)c(-c2cc(C)cc(C)c2O)c1 |
| InChI | InChI=1S/C17H20O/c1-10-6-12(3)14(5)15(8-10)16-9-11(2)7-13(4)17(16)18/h6-9,18H,1-5H3 |
| InChIKey | HFKMWJRLAMPFCT-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,4-dimethyl-6-(2,3,5-trimethylphenyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethyl-6-(2,3,5-trimethylphenyl)phenol?
The IUPAC name of 2,4-dimethyl-6-(2,3,5-trimethylphenyl)phenol (CID 90291954) is 2,4-dimethyl-6-(2,3,5-trimethylphenyl)phenol.
What is the SMILES notation for 2,4-dimethyl-6-(2,3,5-trimethylphenyl)phenol?
The canonical SMILES for 2,4-dimethyl-6-(2,3,5-trimethylphenyl)phenol is Cc1cc(C)c(C)c(-c2cc(C)cc(C)c2O)c1.
What is the InChIKey of 2,4-dimethyl-6-(2,3,5-trimethylphenyl)phenol?
The InChIKey is HFKMWJRLAMPFCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20O/c1-10-6-12(3)14(5)15(8-10)16-9-11(2)7-13(4)17(16)18/h6-9,18H,1-5H3.
What are the key properties of 2,4-dimethyl-6-(2,3,5-trimethylphenyl)phenol?
2,4-dimethyl-6-(2,3,5-trimethylphenyl)phenol has a molecular weight of 240.35 g/mol, XLogP of 4.60, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethyl-6-(2,3,5-trimethylphenyl)phenol is sourced from PubChem (CID 90291954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).