C16H19NO5 — CID 90292250
(3aS,4S,5R,6S,7aS)-5-methyl-2-oxo-4-phenylmethoxy-3a,4,5,6,7,7a-hexahydro-3H-1,3-benzoxazole-6-carboxylic acid (PubChem CID 90292250) has the molecular formula C16H19NO5 and a molecular weight of 305.33 g/mol. Its IUPAC name is (3aS,4S,5R,6S,7aS)-5-methyl-2-oxo-4-phenylmethoxy-3a,4,5,6,7,7a-hexahydro-3H-1,3-benzoxazole-6-carboxylic acid.
| Compound Name | (3aS,4S,5R,6S,7aS)-5-methyl-2-oxo-4-phenylmethoxy-3a,4,5,6,7,7a-hexahydro-3H-1,3-benzoxazole-6-carboxylic acid |
|---|---|
| PubChem CID | 90292250 |
| Molecular Formula | C16H19NO5 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | (3aS,4S,5R,6S,7aS)-5-methyl-2-oxo-4-phenylmethoxy-3a,4,5,6,7,7a-hexahydro-3H-1,3-benzoxazole-6-carboxylic acid |
| SMILES | C[C@H]1[C@H](OCc2ccccc2)[C@H]2NC(=O)O[C@H]2C[C@@H]1C(=O)O |
| InChI | InChI=1S/C16H19NO5/c1-9-11(15(18)19)7-12-13(17-16(20)22-12)14(9)21-8-10-5-3-2-4-6-10/h2-6,9,11-14H,7-8H2,1H3,(H,17,20)(H,18,19)/t9-,11+,12+,13+,14+/m1/s1 |
| InChIKey | VSDJXSXHQULNMQ-QJPDTAOJSA-N |
| XLogP | 1.79 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |