C26H24F3N3O3 — CID 90292390
1-[5-methyl-2-(trifluoromethoxymethyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-7-yl]-4-phenylmethoxypyridin-2-one (PubChem CID 90292390) has the molecular formula C26H24F3N3O3 and a molecular weight of 483.49 g/mol. Its IUPAC name is 1-[5-methyl-2-(trifluoromethoxymethyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-7-yl]-4-phenylmethoxypyridin-2-one.
| Compound Name | 1-[5-methyl-2-(trifluoromethoxymethyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-7-yl]-4-phenylmethoxypyridin-2-one |
|---|---|
| PubChem CID | 90292390 |
| Molecular Formula | C26H24F3N3O3 |
| Molecular Weight | 483.49 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | 1-[5-methyl-2-(trifluoromethoxymethyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-7-yl]-4-phenylmethoxypyridin-2-one |
| SMILES | Cn1c2c(c3ccc(-n4ccc(OCc5ccccc5)cc4=O)cc31)CN(COC(F)(F)F)CC2 |
| InChI | InChI=1S/C26H24F3N3O3/c1-30-23-10-11-31(17-35-26(27,28)29)15-22(23)21-8-7-19(13-24(21)30)32-12-9-20(14-25(32)33)34-16-18-5-3-2-4-6-18/h2-9,12-14H,10-11,15-17H2,1H3 |
| InChIKey | XSOTYIYLNJJSDT-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 48.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.49 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|