About 3-bromo-N-(4,5-dihydro-1,3-thiazol-2-yl)benzamide
3-bromo-N-(4,5-dihydro-1,3-thiazol-2-yl)benzamide (PubChem CID 902925) has the molecular formula C10H9BrN2OS
and a molecular weight of 285.17 g/mol. Its IUPAC name is 3-bromo-N-(4,5-dihydro-1,3-thiazol-2-yl)benzamide.
Molecular Properties
| Compound Name | 3-bromo-N-(4,5-dihydro-1,3-thiazol-2-yl)benzamide |
| PubChem CID | 902925 |
| Molecular Formula | C10H9BrN2OS |
| Molecular Weight | 285.17 g/mol |
| Exact Mass | 283.96 |
| IUPAC Name | 3-bromo-N-(4,5-dihydro-1,3-thiazol-2-yl)benzamide |
| SMILES | O=C(NC1=NCCS1)c1cccc(Br)c1 |
| InChI | InChI=1S/C10H9BrN2OS/c11-8-3-1-2-7(6-8)9(14)13-10-12-4-5-15-10/h1-3,6H,4-5H2,(H,12,13,14) |
| InChIKey | KQAMRXZJRBAQBO-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.17 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-bromo-N-(4,5-dihydro-1,3-thiazol-2-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-N-(4,5-dihydro-1,3-thiazol-2-yl)benzamide?
The IUPAC name of 3-bromo-N-(4,5-dihydro-1,3-thiazol-2-yl)benzamide (CID 902925) is 3-bromo-N-(4,5-dihydro-1,3-thiazol-2-yl)benzamide.
What is the SMILES notation for 3-bromo-N-(4,5-dihydro-1,3-thiazol-2-yl)benzamide?
The canonical SMILES for 3-bromo-N-(4,5-dihydro-1,3-thiazol-2-yl)benzamide is O=C(NC1=NCCS1)c1cccc(Br)c1.
What is the InChIKey of 3-bromo-N-(4,5-dihydro-1,3-thiazol-2-yl)benzamide?
The InChIKey is KQAMRXZJRBAQBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9BrN2OS/c11-8-3-1-2-7(6-8)9(14)13-10-12-4-5-15-10/h1-3,6H,4-5H2,(H,12,13,14).
What are the key properties of 3-bromo-N-(4,5-dihydro-1,3-thiazol-2-yl)benzamide?
3-bromo-N-(4,5-dihydro-1,3-thiazol-2-yl)benzamide has a molecular weight of 285.17 g/mol, XLogP of 2.28, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-N-(4,5-dihydro-1,3-thiazol-2-yl)benzamide is sourced from PubChem (CID 902925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).