About 1-nitrooxypentyl (2S)-2-(6-hydroxynaphthalen-2-yl)propanoate
1-nitrooxypentyl (2S)-2-(6-hydroxynaphthalen-2-yl)propanoate (PubChem CID 90292609) has the molecular formula C18H21NO6
and a molecular weight of 347.37 g/mol. Its IUPAC name is 1-nitrooxypentyl (2S)-2-(6-hydroxynaphthalen-2-yl)propanoate.
Molecular Properties
| Compound Name | 1-nitrooxypentyl (2S)-2-(6-hydroxynaphthalen-2-yl)propanoate |
| PubChem CID | 90292609 |
| Molecular Formula | C18H21NO6 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 1-nitrooxypentyl (2S)-2-(6-hydroxynaphthalen-2-yl)propanoate |
| SMILES | CCCCC(OC(=O)[C@@H](C)c1ccc2cc(O)ccc2c1)O[N+](=O)[O-] |
| InChI | InChI=1S/C18H21NO6/c1-3-4-5-17(25-19(22)23)24-18(21)12(2)13-6-7-15-11-16(20)9-8-14(15)10-13/h6-12,17,20H,3-5H2,1-2H3/t12-,17?/m0/s1 |
| InChIKey | XFFNVUKSMPVYQE-WHUIICBVSA-N |
| XLogP | 3.92 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-nitrooxypentyl (2S)-2-(6-hydroxynaphthalen-2-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-nitrooxypentyl (2S)-2-(6-hydroxynaphthalen-2-yl)propanoate?
The IUPAC name of 1-nitrooxypentyl (2S)-2-(6-hydroxynaphthalen-2-yl)propanoate (CID 90292609) is 1-nitrooxypentyl (2S)-2-(6-hydroxynaphthalen-2-yl)propanoate.
What is the SMILES notation for 1-nitrooxypentyl (2S)-2-(6-hydroxynaphthalen-2-yl)propanoate?
The canonical SMILES for 1-nitrooxypentyl (2S)-2-(6-hydroxynaphthalen-2-yl)propanoate is CCCCC(OC(=O)[C@@H](C)c1ccc2cc(O)ccc2c1)O[N+](=O)[O-].
What is the InChIKey of 1-nitrooxypentyl (2S)-2-(6-hydroxynaphthalen-2-yl)propanoate?
The InChIKey is XFFNVUKSMPVYQE-WHUIICBVSA-N. The full InChI is InChI=1S/C18H21NO6/c1-3-4-5-17(25-19(22)23)24-18(21)12(2)13-6-7-15-11-16(20)9-8-14(15)10-13/h6-12,17,20H,3-5H2,1-2H3/t12-,17?/m0/s1.
What are the key properties of 1-nitrooxypentyl (2S)-2-(6-hydroxynaphthalen-2-yl)propanoate?
1-nitrooxypentyl (2S)-2-(6-hydroxynaphthalen-2-yl)propanoate has a molecular weight of 347.37 g/mol, XLogP of 3.92, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-nitrooxypentyl (2S)-2-(6-hydroxynaphthalen-2-yl)propanoate is sourced from PubChem (CID 90292609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).