About tert-butyl 3-[1-(3,3-difluorocyclopentyl)-3-iodopyrazol-5-yl]azetidine-1-carboxylate
tert-butyl 3-[1-(3,3-difluorocyclopentyl)-3-iodopyrazol-5-yl]azetidine-1-carboxylate (PubChem CID 90292797) has the molecular formula C16H22F2IN3O2
and a molecular weight of 453.27 g/mol. Its IUPAC name is tert-butyl 3-[1-(3,3-difluorocyclopentyl)-3-iodopyrazol-5-yl]azetidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 3-[1-(3,3-difluorocyclopentyl)-3-iodopyrazol-5-yl]azetidine-1-carboxylate |
| PubChem CID | 90292797 |
| Molecular Formula | C16H22F2IN3O2 |
| Molecular Weight | 453.27 g/mol |
| Exact Mass | 453.07 |
| IUPAC Name | tert-butyl 3-[1-(3,3-difluorocyclopentyl)-3-iodopyrazol-5-yl]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(c2cc(I)nn2C2CCC(F)(F)C2)C1 |
| InChI | InChI=1S/C16H22F2IN3O2/c1-15(2,3)24-14(23)21-8-10(9-21)12-6-13(19)20-22(12)11-4-5-16(17,18)7-11/h6,10-11H,4-5,7-9H2,1-3H3 |
| InChIKey | RLUHPSWRQXNLEA-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 453.27 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 3-[1-(3,3-difluorocyclopentyl)-3-iodopyrazol-5-yl]azetidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-[1-(3,3-difluorocyclopentyl)-3-iodopyrazol-5-yl]azetidine-1-carboxylate?
The IUPAC name of tert-butyl 3-[1-(3,3-difluorocyclopentyl)-3-iodopyrazol-5-yl]azetidine-1-carboxylate (CID 90292797) is tert-butyl 3-[1-(3,3-difluorocyclopentyl)-3-iodopyrazol-5-yl]azetidine-1-carboxylate.
What is the SMILES notation for tert-butyl 3-[1-(3,3-difluorocyclopentyl)-3-iodopyrazol-5-yl]azetidine-1-carboxylate?
The canonical SMILES for tert-butyl 3-[1-(3,3-difluorocyclopentyl)-3-iodopyrazol-5-yl]azetidine-1-carboxylate is CC(C)(C)OC(=O)N1CC(c2cc(I)nn2C2CCC(F)(F)C2)C1.
What is the InChIKey of tert-butyl 3-[1-(3,3-difluorocyclopentyl)-3-iodopyrazol-5-yl]azetidine-1-carboxylate?
The InChIKey is RLUHPSWRQXNLEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22F2IN3O2/c1-15(2,3)24-14(23)21-8-10(9-21)12-6-13(19)20-22(12)11-4-5-16(17,18)7-11/h6,10-11H,4-5,7-9H2,1-3H3.
What are the key properties of tert-butyl 3-[1-(3,3-difluorocyclopentyl)-3-iodopyrazol-5-yl]azetidine-1-carboxylate?
tert-butyl 3-[1-(3,3-difluorocyclopentyl)-3-iodopyrazol-5-yl]azetidine-1-carboxylate has a molecular weight of 453.27 g/mol, XLogP of 4.18, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-[1-(3,3-difluorocyclopentyl)-3-iodopyrazol-5-yl]azetidine-1-carboxylate is sourced from PubChem (CID 90292797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).