C17H16F3N3O3 — CID 90293236
5-(1,3-dioxolan-2-yl)-2,3,4-trifluoro-N'-(2-hydroxy-1-pyridin-4-ylethyl)benzenecarboximidamide (PubChem CID 90293236) has the molecular formula C17H16F3N3O3 and a molecular weight of 367.33 g/mol. Its IUPAC name is 5-(1,3-dioxolan-2-yl)-2,3,4-trifluoro-N'-(2-hydroxy-1-pyridin-4-ylethyl)benzenecarboximidamide.
| Compound Name | 5-(1,3-dioxolan-2-yl)-2,3,4-trifluoro-N'-(2-hydroxy-1-pyridin-4-ylethyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 90293236 |
| Molecular Formula | C17H16F3N3O3 |
| Molecular Weight | 367.33 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 5-(1,3-dioxolan-2-yl)-2,3,4-trifluoro-N'-(2-hydroxy-1-pyridin-4-ylethyl)benzenecarboximidamide |
| SMILES | N/C(=N\C(CO)c1ccncc1)c1cc(C2OCCO2)c(F)c(F)c1F |
| InChI | InChI=1S/C17H16F3N3O3/c18-13-10(7-11(14(19)15(13)20)17-25-5-6-26-17)16(21)23-12(8-24)9-1-3-22-4-2-9/h1-4,7,12,17,24H,5-6,8H2,(H2,21,23) |
| InChIKey | YWKHVEWURFEJTM-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 89.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.33 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|