C38H28F12N6 — CID 90293295
2-[8-[4,6-bis(trifluoromethyl)-1,3,5-triazin-2-yl]-3,6-dicyclohexylpyren-1-yl]-4,6-bis(trifluoromethyl)-1,3,5-triazine (PubChem CID 90293295) has the molecular formula C38H28F12N6 and a molecular weight of 796.66 g/mol. Its IUPAC name is 2-[8-[4,6-bis(trifluoromethyl)-1,3,5-triazin-2-yl]-3,6-dicyclohexylpyren-1-yl]-4,6-bis(trifluoromethyl)-1,3,5-triazine.
| Compound Name | 2-[8-[4,6-bis(trifluoromethyl)-1,3,5-triazin-2-yl]-3,6-dicyclohexylpyren-1-yl]-4,6-bis(trifluoromethyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 90293295 |
| Molecular Formula | C38H28F12N6 |
| Molecular Weight | 796.66 g/mol |
| Exact Mass | 796.22 |
| IUPAC Name | 2-[8-[4,6-bis(trifluoromethyl)-1,3,5-triazin-2-yl]-3,6-dicyclohexylpyren-1-yl]-4,6-bis(trifluoromethyl)-1,3,5-triazine |
| SMILES | FC(F)(F)c1nc(-c2cc(C3CCCCC3)c3ccc4c(C5CCCCC5)cc(-c5nc(C(F)(F)F)nc(C(F)(F)F)n5)c5ccc2c3c54)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C38H28F12N6/c39-35(40,41)31-51-29(52-32(55-31)36(42,43)44)25-15-23(17-7-3-1-4-8-17)19-11-12-20-24(18-9-5-2-6-10-18)16-26(22-14-13-21(25)27(19)28(20)22)30-53-33(37(45,46)47)56-34(54-30)38(48,49)50/h11-18H,1-10H2 |
| InChIKey | ABXRADHLZUGQNL-UHFFFAOYSA-N |
| XLogP | 12.46 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.66 |
| LogP ≤ 5 | 12.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|