C48H54N4 — CID 90293300
4,6-ditert-butyl-2-[8-(4,6-ditert-butylpyrimidin-2-yl)-4-(4-ethylphenyl)pyren-1-yl]pyrimidine (PubChem CID 90293300) has the molecular formula C48H54N4 and a molecular weight of 686.99 g/mol. Its IUPAC name is 4,6-ditert-butyl-2-[8-(4,6-ditert-butylpyrimidin-2-yl)-4-(4-ethylphenyl)pyren-1-yl]pyrimidine.
| Compound Name | 4,6-ditert-butyl-2-[8-(4,6-ditert-butylpyrimidin-2-yl)-4-(4-ethylphenyl)pyren-1-yl]pyrimidine |
|---|---|
| PubChem CID | 90293300 |
| Molecular Formula | C48H54N4 |
| Molecular Weight | 686.99 g/mol |
| Exact Mass | 686.43 |
| IUPAC Name | 4,6-ditert-butyl-2-[8-(4,6-ditert-butylpyrimidin-2-yl)-4-(4-ethylphenyl)pyren-1-yl]pyrimidine |
| SMILES | CCc1ccc(-c2cc3ccc(-c4nc(C(C)(C)C)cc(C(C)(C)C)n4)c4ccc5c(-c6nc(C(C)(C)C)cc(C(C)(C)C)n6)ccc2c5c34)cc1 |
| InChI | InChI=1S/C48H54N4/c1-14-28-15-17-29(18-16-28)36-25-30-19-20-34(43-49-37(45(2,3)4)26-38(50-43)46(5,6)7)31-21-22-32-35(24-23-33(36)42(32)41(30)31)44-51-39(47(8,9)10)27-40(52-44)48(11,12)13/h15-27H,14H2,1-13H3 |
| InChIKey | ZGVOYQUXHYMFPZ-UHFFFAOYSA-N |
| XLogP | 12.92 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.99 |
| LogP ≤ 5 | 12.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|