C50H40N2 — CID 90293327
5-[7-(3,5-dimethylphenyl)-3-(4,6-dimethyl-3-pyridinyl)-5,9-diphenylpyren-1-yl]-2,4-dimethylpyridine (PubChem CID 90293327) has the molecular formula C50H40N2 and a molecular weight of 668.88 g/mol. Its IUPAC name is 5-[7-(3,5-dimethylphenyl)-3-(4,6-dimethyl-3-pyridinyl)-5,9-diphenylpyren-1-yl]-2,4-dimethylpyridine.
| Compound Name | 5-[7-(3,5-dimethylphenyl)-3-(4,6-dimethyl-3-pyridinyl)-5,9-diphenylpyren-1-yl]-2,4-dimethylpyridine |
|---|---|
| PubChem CID | 90293327 |
| Molecular Formula | C50H40N2 |
| Molecular Weight | 668.88 g/mol |
| Exact Mass | 668.32 |
| IUPAC Name | 5-[7-(3,5-dimethylphenyl)-3-(4,6-dimethyl-3-pyridinyl)-5,9-diphenylpyren-1-yl]-2,4-dimethylpyridine |
| SMILES | Cc1cc(C)cc(-c2cc3c(-c4ccccc4)cc4c(-c5cnc(C)cc5C)cc(-c5cnc(C)cc5C)c5cc(-c6ccccc6)c(c2)c3c45)c1 |
| InChI | InChI=1S/C50H40N2/c1-29-17-30(2)19-37(18-29)38-22-43-39(35-13-9-7-10-14-35)24-45-41(47-27-51-33(5)20-31(47)3)26-42(48-28-52-34(6)21-32(48)4)46-25-40(36-15-11-8-12-16-36)44(23-38)49(43)50(45)46/h7-28H,1-6H3 |
| InChIKey | UEZLAQWYIXINLQ-UHFFFAOYSA-N |
| XLogP | 13.56 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.88 |
| LogP ≤ 5 | 13.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|