C26H16ClN3OS2 — CID 90293554
6-(chloromethyl)-4,7-bis(5-phenylthiophen-2-yl)-[1,2,5]oxadiazolo[3,4-c]pyridine (PubChem CID 90293554) has the molecular formula C26H16ClN3OS2 and a molecular weight of 486.02 g/mol. Its IUPAC name is 6-(chloromethyl)-4,7-bis(5-phenylthiophen-2-yl)-[1,2,5]oxadiazolo[3,4-c]pyridine.
| Compound Name | 6-(chloromethyl)-4,7-bis(5-phenylthiophen-2-yl)-[1,2,5]oxadiazolo[3,4-c]pyridine |
|---|---|
| PubChem CID | 90293554 |
| Molecular Formula | C26H16ClN3OS2 |
| Molecular Weight | 486.02 g/mol |
| Exact Mass | 485.04 |
| IUPAC Name | 6-(chloromethyl)-4,7-bis(5-phenylthiophen-2-yl)-[1,2,5]oxadiazolo[3,4-c]pyridine |
| SMILES | ClCc1nc(-c2ccc(-c3ccccc3)s2)c2nonc2c1-c1ccc(-c2ccccc2)s1 |
| InChI | InChI=1S/C26H16ClN3OS2/c27-15-18-23(21-13-11-19(32-21)16-7-3-1-4-8-16)25-26(30-31-29-25)24(28-18)22-14-12-20(33-22)17-9-5-2-6-10-17/h1-14H,15H2 |
| InChIKey | DKJSIXCWFAWLJB-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.02 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|