C23H34N2O — CID 90294072
1-[(3,9-dimethyl-1,2,4,5-tetrahydroazepino[4,5-b]indol-6-yl)methyl]-3,5-dimethylcyclohexan-1-ol (PubChem CID 90294072) has the molecular formula C23H34N2O and a molecular weight of 354.54 g/mol. Its IUPAC name is 1-[(3,9-dimethyl-1,2,4,5-tetrahydroazepino[4,5-b]indol-6-yl)methyl]-3,5-dimethylcyclohexan-1-ol.
| Compound Name | 1-[(3,9-dimethyl-1,2,4,5-tetrahydroazepino[4,5-b]indol-6-yl)methyl]-3,5-dimethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 90294072 |
| Molecular Formula | C23H34N2O |
| Molecular Weight | 354.54 g/mol |
| Exact Mass | 354.27 |
| IUPAC Name | 1-[(3,9-dimethyl-1,2,4,5-tetrahydroazepino[4,5-b]indol-6-yl)methyl]-3,5-dimethylcyclohexan-1-ol |
| SMILES | Cc1ccc2c(c1)c1c(n2CC2(O)CC(C)CC(C)C2)CCN(C)CC1 |
| InChI | InChI=1S/C23H34N2O/c1-16-5-6-21-20(12-16)19-7-9-24(4)10-8-22(19)25(21)15-23(26)13-17(2)11-18(3)14-23/h5-6,12,17-18,26H,7-11,13-15H2,1-4H3 |
| InChIKey | REZFLEOHKFACCU-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 28.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.54 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|