C21H26F3N3O4S — CID 90294282
3-[[2-methyl-2-[(2,3,4-trifluorophenyl)sulfonylamino]propanoyl]amino]adamantane-1-carboxamide (PubChem CID 90294282) has the molecular formula C21H26F3N3O4S and a molecular weight of 473.52 g/mol. Its IUPAC name is 3-[[2-methyl-2-[(2,3,4-trifluorophenyl)sulfonylamino]propanoyl]amino]adamantane-1-carboxamide.
| Compound Name | 3-[[2-methyl-2-[(2,3,4-trifluorophenyl)sulfonylamino]propanoyl]amino]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 90294282 |
| Molecular Formula | C21H26F3N3O4S |
| Molecular Weight | 473.52 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | 3-[[2-methyl-2-[(2,3,4-trifluorophenyl)sulfonylamino]propanoyl]amino]adamantane-1-carboxamide |
| SMILES | CC(C)(NS(=O)(=O)c1ccc(F)c(F)c1F)C(=O)NC12CC3CC(C1)CC(C(N)=O)(C3)C2 |
| InChI | InChI=1S/C21H26F3N3O4S/c1-19(2,27-32(30,31)14-4-3-13(22)15(23)16(14)24)18(29)26-21-8-11-5-12(9-21)7-20(6-11,10-21)17(25)28/h3-4,11-12,27H,5-10H2,1-2H3,(H2,25,28)(H,26,29) |
| InChIKey | KPKQZDQRCAGMTR-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.52 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|