C30H36N4O7 — CID 90294452
(2R)-2-[[amino-[[2-(2,3,4-trimethoxyphenyl)acetyl]amino]methylidene]amino]-N-[(3,4-dimethoxyphenyl)methyl]-3-phenylpropanamide (PubChem CID 90294452) has the molecular formula C30H36N4O7 and a molecular weight of 564.64 g/mol. Its IUPAC name is (2R)-2-[[amino-[[2-(2,3,4-trimethoxyphenyl)acetyl]amino]methylidene]amino]-N-[(3,4-dimethoxyphenyl)methyl]-3-phenylpropanamide.
| Compound Name | (2R)-2-[[amino-[[2-(2,3,4-trimethoxyphenyl)acetyl]amino]methylidene]amino]-N-[(3,4-dimethoxyphenyl)methyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 90294452 |
| Molecular Formula | C30H36N4O7 |
| Molecular Weight | 564.64 g/mol |
| Exact Mass | 564.26 |
| IUPAC Name | (2R)-2-[[amino-[[2-(2,3,4-trimethoxyphenyl)acetyl]amino]methylidene]amino]-N-[(3,4-dimethoxyphenyl)methyl]-3-phenylpropanamide |
| SMILES | COc1ccc(CNC(=O)[C@@H](Cc2ccccc2)/N=C(\N)NC(=O)Cc2ccc(OC)c(OC)c2OC)cc1OC |
| InChI | InChI=1S/C30H36N4O7/c1-37-23-13-11-20(16-25(23)39-3)18-32-29(36)22(15-19-9-7-6-8-10-19)33-30(31)34-26(35)17-21-12-14-24(38-2)28(41-5)27(21)40-4/h6-14,16,22H,15,17-18H2,1-5H3,(H,32,36)(H3,31,33,34,35)/t22-/m1/s1 |
| InChIKey | SLOZCDCDYRZMHJ-JOCHJYFZSA-N |
| XLogP | 2.63 |
| TPSA | 142.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.64 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|