C25H34N4O5 — CID 90294683
(2R)-2-[[amino-[[2-(3-methoxyphenyl)acetyl]amino]methylidene]amino]-N-[(3,4-dimethoxyphenyl)methyl]-4-methylpentanamide (PubChem CID 90294683) has the molecular formula C25H34N4O5 and a molecular weight of 470.57 g/mol. Its IUPAC name is (2R)-2-[[amino-[[2-(3-methoxyphenyl)acetyl]amino]methylidene]amino]-N-[(3,4-dimethoxyphenyl)methyl]-4-methylpentanamide.
| Compound Name | (2R)-2-[[amino-[[2-(3-methoxyphenyl)acetyl]amino]methylidene]amino]-N-[(3,4-dimethoxyphenyl)methyl]-4-methylpentanamide |
|---|---|
| PubChem CID | 90294683 |
| Molecular Formula | C25H34N4O5 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | (2R)-2-[[amino-[[2-(3-methoxyphenyl)acetyl]amino]methylidene]amino]-N-[(3,4-dimethoxyphenyl)methyl]-4-methylpentanamide |
| SMILES | COc1cccc(CC(=O)N/C(N)=N/[C@H](CC(C)C)C(=O)NCc2ccc(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C25H34N4O5/c1-16(2)11-20(24(31)27-15-18-9-10-21(33-4)22(13-18)34-5)28-25(26)29-23(30)14-17-7-6-8-19(12-17)32-3/h6-10,12-13,16,20H,11,14-15H2,1-5H3,(H,27,31)(H3,26,28,29,30)/t20-/m1/s1 |
| InChIKey | DEPKBGUCYAOZRB-HXUWFJFHSA-N |
| XLogP | 2.42 |
| TPSA | 124.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|