C29H34N4O6 — CID 90294693
(2R)-2-[[amino-[[2-(3,5-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-[(3,4-dimethoxyphenyl)methyl]-3-phenylpropanamide (PubChem CID 90294693) has the molecular formula C29H34N4O6 and a molecular weight of 534.61 g/mol. Its IUPAC name is (2R)-2-[[amino-[[2-(3,5-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-[(3,4-dimethoxyphenyl)methyl]-3-phenylpropanamide.
| Compound Name | (2R)-2-[[amino-[[2-(3,5-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-[(3,4-dimethoxyphenyl)methyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 90294693 |
| Molecular Formula | C29H34N4O6 |
| Molecular Weight | 534.61 g/mol |
| Exact Mass | 534.25 |
| IUPAC Name | (2R)-2-[[amino-[[2-(3,5-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-[(3,4-dimethoxyphenyl)methyl]-3-phenylpropanamide |
| SMILES | COc1cc(CC(=O)N/C(N)=N/[C@H](Cc2ccccc2)C(=O)NCc2ccc(OC)c(OC)c2)cc(OC)c1 |
| InChI | InChI=1S/C29H34N4O6/c1-36-22-12-21(13-23(17-22)37-2)16-27(34)33-29(30)32-24(14-19-8-6-5-7-9-19)28(35)31-18-20-10-11-25(38-3)26(15-20)39-4/h5-13,15,17,24H,14,16,18H2,1-4H3,(H,31,35)(H3,30,32,33,34)/t24-/m1/s1 |
| InChIKey | GLHGZAUAAWHWRV-XMMPIXPASA-N |
| XLogP | 2.62 |
| TPSA | 133.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.61 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|