C36H39F3O7S — CID 90294844
[(2R,3R,4R,5R)-2,3,4,5-tetrakis(phenylmethoxy)heptyl] trifluoromethanesulfonate (PubChem CID 90294844) has the molecular formula C36H39F3O7S and a molecular weight of 672.76 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-2,3,4,5-tetrakis(phenylmethoxy)heptyl] trifluoromethanesulfonate.
| Compound Name | [(2R,3R,4R,5R)-2,3,4,5-tetrakis(phenylmethoxy)heptyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 90294844 |
| Molecular Formula | C36H39F3O7S |
| Molecular Weight | 672.76 g/mol |
| Exact Mass | 672.24 |
| IUPAC Name | [(2R,3R,4R,5R)-2,3,4,5-tetrakis(phenylmethoxy)heptyl] trifluoromethanesulfonate |
| SMILES | CC[C@@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@@H](COS(=O)(=O)C(F)(F)F)OCc1ccccc1 |
| InChI | InChI=1S/C36H39F3O7S/c1-2-32(42-23-28-15-7-3-8-16-28)34(44-25-30-19-11-5-12-20-30)35(45-26-31-21-13-6-14-22-31)33(27-46-47(40,41)36(37,38)39)43-24-29-17-9-4-10-18-29/h3-22,32-35H,2,23-27H2,1H3/t32-,33-,34-,35-/m1/s1 |
| InChIKey | OTRUBYPJFZTATK-BAQBVXSRSA-N |
| XLogP | 7.60 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.76 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|