About 2-tert-butyl-3a,7a-dihydro-3H-indole
2-tert-butyl-3a,7a-dihydro-3H-indole (PubChem CID 90295332) has the molecular formula C12H17N
and a molecular weight of 175.27 g/mol. Its IUPAC name is 2-tert-butyl-3a,7a-dihydro-3H-indole.
Molecular Properties
| Compound Name | 2-tert-butyl-3a,7a-dihydro-3H-indole |
| PubChem CID | 90295332 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | 2-tert-butyl-3a,7a-dihydro-3H-indole |
| SMILES | CC(C)(C)C1=NC2C=CC=CC2C1 |
| InChI | InChI=1S/C12H17N/c1-12(2,3)11-8-9-6-4-5-7-10(9)13-11/h4-7,9-10H,8H2,1-3H3 |
| InChIKey | JYTRHRHZYLSTAZ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-tert-butyl-3a,7a-dihydro-3H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-3a,7a-dihydro-3H-indole?
The IUPAC name of 2-tert-butyl-3a,7a-dihydro-3H-indole (CID 90295332) is 2-tert-butyl-3a,7a-dihydro-3H-indole.
What is the SMILES notation for 2-tert-butyl-3a,7a-dihydro-3H-indole?
The canonical SMILES for 2-tert-butyl-3a,7a-dihydro-3H-indole is CC(C)(C)C1=NC2C=CC=CC2C1.
What is the InChIKey of 2-tert-butyl-3a,7a-dihydro-3H-indole?
The InChIKey is JYTRHRHZYLSTAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N/c1-12(2,3)11-8-9-6-4-5-7-10(9)13-11/h4-7,9-10H,8H2,1-3H3.
What are the key properties of 2-tert-butyl-3a,7a-dihydro-3H-indole?
2-tert-butyl-3a,7a-dihydro-3H-indole has a molecular weight of 175.27 g/mol, XLogP of 2.99, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-3a,7a-dihydro-3H-indole is sourced from PubChem (CID 90295332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).