C13H22BN3O2 — CID 90295455
(1S,2S,6R,8S)-4-[(2S)-1-azidopropan-2-yl]-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane (PubChem CID 90295455) has the molecular formula C13H22BN3O2 and a molecular weight of 263.15 g/mol. Its IUPAC name is (1S,2S,6R,8S)-4-[(2S)-1-azidopropan-2-yl]-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane.
| Compound Name | (1S,2S,6R,8S)-4-[(2S)-1-azidopropan-2-yl]-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane |
|---|---|
| PubChem CID | 90295455 |
| Molecular Formula | C13H22BN3O2 |
| Molecular Weight | 263.15 g/mol |
| Exact Mass | 263.18 |
| IUPAC Name | (1S,2S,6R,8S)-4-[(2S)-1-azidopropan-2-yl]-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane |
| SMILES | C[C@@H](CN=[N+]=[N-])B1O[C@@H]2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C13H22BN3O2/c1-8(7-16-17-15)14-18-11-6-9-5-10(12(9,2)3)13(11,4)19-14/h8-11H,5-7H2,1-4H3/t8-,9-,10-,11+,13-/m0/s1 |
| InChIKey | RXCWTSIHKZHTNP-OBBGECFZSA-N |
| XLogP | 3.42 |
| TPSA | 67.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.15 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|