About 2,5-ditert-butyl-6,7-dihydro-5H-cyclopenta[b]pyridine
2,5-ditert-butyl-6,7-dihydro-5H-cyclopenta[b]pyridine (PubChem CID 90295532) has the molecular formula C16H25N
and a molecular weight of 231.38 g/mol. Its IUPAC name is 2,5-ditert-butyl-6,7-dihydro-5H-cyclopenta[b]pyridine.
Molecular Properties
| Compound Name | 2,5-ditert-butyl-6,7-dihydro-5H-cyclopenta[b]pyridine |
| PubChem CID | 90295532 |
| Molecular Formula | C16H25N |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | 2,5-ditert-butyl-6,7-dihydro-5H-cyclopenta[b]pyridine |
| SMILES | CC(C)(C)c1ccc2c(n1)CCC2C(C)(C)C |
| InChI | InChI=1S/C16H25N/c1-15(2,3)12-8-9-13-11(12)7-10-14(17-13)16(4,5)6/h7,10,12H,8-9H2,1-6H3 |
| InChIKey | GUKAAGXXYFYGJV-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,5-ditert-butyl-6,7-dihydro-5H-cyclopenta[b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-ditert-butyl-6,7-dihydro-5H-cyclopenta[b]pyridine?
The IUPAC name of 2,5-ditert-butyl-6,7-dihydro-5H-cyclopenta[b]pyridine (CID 90295532) is 2,5-ditert-butyl-6,7-dihydro-5H-cyclopenta[b]pyridine.
What is the SMILES notation for 2,5-ditert-butyl-6,7-dihydro-5H-cyclopenta[b]pyridine?
The canonical SMILES for 2,5-ditert-butyl-6,7-dihydro-5H-cyclopenta[b]pyridine is CC(C)(C)c1ccc2c(n1)CCC2C(C)(C)C.
What is the InChIKey of 2,5-ditert-butyl-6,7-dihydro-5H-cyclopenta[b]pyridine?
The InChIKey is GUKAAGXXYFYGJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25N/c1-15(2,3)12-8-9-13-11(12)7-10-14(17-13)16(4,5)6/h7,10,12H,8-9H2,1-6H3.
What are the key properties of 2,5-ditert-butyl-6,7-dihydro-5H-cyclopenta[b]pyridine?
2,5-ditert-butyl-6,7-dihydro-5H-cyclopenta[b]pyridine has a molecular weight of 231.38 g/mol, XLogP of 4.45, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-ditert-butyl-6,7-dihydro-5H-cyclopenta[b]pyridine is sourced from PubChem (CID 90295532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).