C30H41N3O8 — CID 90295677
methyl (1R,22S)-22-tert-butyl-3,20,23-trioxospiro[2,12,19-trioxa-4,21,24-triazatetracyclo[22.2.1.14,7.06,11]octacosa-6,8,10-triene-17,1'-cyclopropane]-25-carboxylate (PubChem CID 90295677) has the molecular formula C30H41N3O8 and a molecular weight of 571.67 g/mol. Its IUPAC name is methyl (1R,22S)-22-tert-butyl-3,20,23-trioxospiro[2,12,19-trioxa-4,21,24-triazatetracyclo[22.2.1.14,7.06,11]octacosa-6,8,10-triene-17,1'-cyclopropane]-25-carboxylate.
| Compound Name | methyl (1R,22S)-22-tert-butyl-3,20,23-trioxospiro[2,12,19-trioxa-4,21,24-triazatetracyclo[22.2.1.14,7.06,11]octacosa-6,8,10-triene-17,1'-cyclopropane]-25-carboxylate |
|---|---|
| PubChem CID | 90295677 |
| Molecular Formula | C30H41N3O8 |
| Molecular Weight | 571.67 g/mol |
| Exact Mass | 571.29 |
| IUPAC Name | methyl (1R,22S)-22-tert-butyl-3,20,23-trioxospiro[2,12,19-trioxa-4,21,24-triazatetracyclo[22.2.1.14,7.06,11]octacosa-6,8,10-triene-17,1'-cyclopropane]-25-carboxylate |
| SMILES | COC(=O)C1C[C@@H]2CN1C(=O)[C@H](C(C)(C)C)NC(=O)OCC1(CCCCOc3cccc4c3CN(C4)C(=O)O2)CC1 |
| InChI | InChI=1S/C30H41N3O8/c1-29(2,3)24-25(34)33-16-20(14-22(33)26(35)38-4)41-28(37)32-15-19-8-7-9-23(21(19)17-32)39-13-6-5-10-30(11-12-30)18-40-27(36)31-24/h7-9,20,22,24H,5-6,10-18H2,1-4H3,(H,31,36)/t20-,22?,24-/m1/s1 |
| InChIKey | NASWBKXWQLLKGI-YQNXBIPGSA-N |
| XLogP | 3.77 |
| TPSA | 123.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.67 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|