C30H43N3O8 — CID 90295740
(1R,25S)-25-tert-butyl-3,23,26-trioxo-2,12,22-trioxa-4,24,27-triazatetracyclo[25.2.1.14,7.06,11]hentriaconta-6,8,10-triene-28-carboxylic acid (PubChem CID 90295740) has the molecular formula C30H43N3O8 and a molecular weight of 573.69 g/mol. Its IUPAC name is (1R,25S)-25-tert-butyl-3,23,26-trioxo-2,12,22-trioxa-4,24,27-triazatetracyclo[25.2.1.14,7.06,11]hentriaconta-6,8,10-triene-28-carboxylic acid.
| Compound Name | (1R,25S)-25-tert-butyl-3,23,26-trioxo-2,12,22-trioxa-4,24,27-triazatetracyclo[25.2.1.14,7.06,11]hentriaconta-6,8,10-triene-28-carboxylic acid |
|---|---|
| PubChem CID | 90295740 |
| Molecular Formula | C30H43N3O8 |
| Molecular Weight | 573.69 g/mol |
| Exact Mass | 573.31 |
| IUPAC Name | (1R,25S)-25-tert-butyl-3,23,26-trioxo-2,12,22-trioxa-4,24,27-triazatetracyclo[25.2.1.14,7.06,11]hentriaconta-6,8,10-triene-28-carboxylic acid |
| SMILES | CC(C)(C)[C@@H]1NC(=O)OCCCCCCCCCOc2cccc3c2CN(C3)C(=O)O[C@@H]2CC(C(=O)O)N(C2)C1=O |
| InChI | InChI=1S/C30H43N3O8/c1-30(2,3)25-26(34)33-18-21(16-23(33)27(35)36)41-29(38)32-17-20-12-11-13-24(22(20)19-32)39-14-9-7-5-4-6-8-10-15-40-28(37)31-25/h11-13,21,23,25H,4-10,14-19H2,1-3H3,(H,31,37)(H,35,36)/t21-,23?,25-/m1/s1 |
| InChIKey | DDZJPOXARDOCKJ-MOGRSXHUSA-N |
| XLogP | 4.46 |
| TPSA | 134.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.69 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |