C28H34FNO2 — CID 90295882
(4-cyclopropylphenyl)-[1-[(3R,4S,5S,6R)-6-ethyl-3,4,5-trimethyloxan-2-yl]-4-fluoroindol-3-yl]methanol (PubChem CID 90295882) has the molecular formula C28H34FNO2 and a molecular weight of 435.58 g/mol. Its IUPAC name is (4-cyclopropylphenyl)-[1-[(3R,4S,5S,6R)-6-ethyl-3,4,5-trimethyloxan-2-yl]-4-fluoroindol-3-yl]methanol.
| Compound Name | (4-cyclopropylphenyl)-[1-[(3R,4S,5S,6R)-6-ethyl-3,4,5-trimethyloxan-2-yl]-4-fluoroindol-3-yl]methanol |
|---|---|
| PubChem CID | 90295882 |
| Molecular Formula | C28H34FNO2 |
| Molecular Weight | 435.58 g/mol |
| Exact Mass | 435.26 |
| IUPAC Name | (4-cyclopropylphenyl)-[1-[(3R,4S,5S,6R)-6-ethyl-3,4,5-trimethyloxan-2-yl]-4-fluoroindol-3-yl]methanol |
| SMILES | CC[C@H]1OC(n2cc(C(O)c3ccc(C4CC4)cc3)c3c(F)cccc32)[C@H](C)[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C28H34FNO2/c1-5-25-17(3)16(2)18(4)28(32-25)30-15-22(26-23(29)7-6-8-24(26)30)27(31)21-13-11-20(12-14-21)19-9-10-19/h6-8,11-19,25,27-28,31H,5,9-10H2,1-4H3/t16-,17-,18+,25+,27?,28?/m0/s1 |
| InChIKey | BTRSPKXSEQIYGD-AWOZXTTASA-N |
| XLogP | 6.96 |
| TPSA | 34.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.58 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |