C36H24F6N4 — CID 90295934
2-[3-[3,5-bis(trifluoromethyl)phenyl]-8-(4,6-dimethylpyrimidin-2-yl)pyren-1-yl]-4,6-dimethylpyrimidine (PubChem CID 90295934) has the molecular formula C36H24F6N4 and a molecular weight of 626.60 g/mol. Its IUPAC name is 2-[3-[3,5-bis(trifluoromethyl)phenyl]-8-(4,6-dimethylpyrimidin-2-yl)pyren-1-yl]-4,6-dimethylpyrimidine.
| Compound Name | 2-[3-[3,5-bis(trifluoromethyl)phenyl]-8-(4,6-dimethylpyrimidin-2-yl)pyren-1-yl]-4,6-dimethylpyrimidine |
|---|---|
| PubChem CID | 90295934 |
| Molecular Formula | C36H24F6N4 |
| Molecular Weight | 626.60 g/mol |
| Exact Mass | 626.19 |
| IUPAC Name | 2-[3-[3,5-bis(trifluoromethyl)phenyl]-8-(4,6-dimethylpyrimidin-2-yl)pyren-1-yl]-4,6-dimethylpyrimidine |
| SMILES | Cc1cc(C)nc(-c2ccc3ccc4c(-c5cc(C(F)(F)F)cc(C(F)(F)F)c5)cc(-c5nc(C)cc(C)n5)c5ccc2c3c45)n1 |
| InChI | InChI=1S/C36H24F6N4/c1-17-11-18(2)44-33(43-17)28-8-6-21-5-7-26-29(22-13-23(35(37,38)39)15-24(14-22)36(40,41)42)16-30(34-45-19(3)12-20(4)46-34)27-10-9-25(28)31(21)32(26)27/h5-16H,1-4H3 |
| InChIKey | UIFBHKJXCHBFLW-UHFFFAOYSA-N |
| XLogP | 10.44 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.60 |
| LogP ≤ 5 | 10.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|