C12H21NO2 — CID 90295943
tert-butyl 4-methyl-2,3,6,7-tetrahydroazepine-1-carboxylate (PubChem CID 90295943) has the molecular formula C12H21NO2 and a molecular weight of 211.31 g/mol. Its IUPAC name is tert-butyl 4-methyl-2,3,6,7-tetrahydroazepine-1-carboxylate.
| Compound Name | tert-butyl 4-methyl-2,3,6,7-tetrahydroazepine-1-carboxylate |
|---|---|
| PubChem CID | 90295943 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | tert-butyl 4-methyl-2,3,6,7-tetrahydroazepine-1-carboxylate |
| SMILES | CC1=CCCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C12H21NO2/c1-10-6-5-8-13(9-7-10)11(14)15-12(2,3)4/h6H,5,7-9H2,1-4H3 |
| InChIKey | IGYVDGQMUIGNQP-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|