C40H28F6N8 — CID 90296000
2-(2,6-dimethyl-3-pyridinyl)-4-[3-[4-(2,6-dimethyl-3-pyridinyl)-6-methyl-1,3,5-triazin-2-yl]-6,8-bis(trifluoromethyl)pyren-1-yl]-6-methyl-1,3,5-triazine (PubChem CID 90296000) has the molecular formula C40H28F6N8 and a molecular weight of 734.71 g/mol. Its IUPAC name is 2-(2,6-dimethyl-3-pyridinyl)-4-[3-[4-(2,6-dimethyl-3-pyridinyl)-6-methyl-1,3,5-triazin-2-yl]-6,8-bis(trifluoromethyl)pyren-1-yl]-6-methyl-1,3,5-triazine.
| Compound Name | 2-(2,6-dimethyl-3-pyridinyl)-4-[3-[4-(2,6-dimethyl-3-pyridinyl)-6-methyl-1,3,5-triazin-2-yl]-6,8-bis(trifluoromethyl)pyren-1-yl]-6-methyl-1,3,5-triazine |
|---|---|
| PubChem CID | 90296000 |
| Molecular Formula | C40H28F6N8 |
| Molecular Weight | 734.71 g/mol |
| Exact Mass | 734.23 |
| IUPAC Name | 2-(2,6-dimethyl-3-pyridinyl)-4-[3-[4-(2,6-dimethyl-3-pyridinyl)-6-methyl-1,3,5-triazin-2-yl]-6,8-bis(trifluoromethyl)pyren-1-yl]-6-methyl-1,3,5-triazine |
| SMILES | Cc1ccc(-c2nc(C)nc(-c3cc(-c4nc(C)nc(-c5ccc(C)nc5C)n4)c4ccc5c(C(F)(F)F)cc(C(F)(F)F)c6ccc3c4c65)n2)c(C)n1 |
| InChI | InChI=1S/C40H28F6N8/c1-17-7-9-23(19(3)47-17)35-49-21(5)51-37(53-35)29-15-30(38-52-22(6)50-36(54-38)24-10-8-18(2)48-20(24)4)26-12-14-28-32(40(44,45)46)16-31(39(41,42)43)27-13-11-25(29)33(26)34(27)28/h7-16H,1-6H3 |
| InChIKey | TWPWLGWFZMTHNI-UHFFFAOYSA-N |
| XLogP | 10.30 |
| TPSA | 103.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.71 |
| LogP ≤ 5 | 10.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|