C47H30N4S — CID 90296146
10-(3,5-diphenylphenyl)-6-(4,6-diphenyl-1,3,5-triazin-2-yl)-[1]benzothiolo[3,2-b]indole (PubChem CID 90296146) has the molecular formula C47H30N4S and a molecular weight of 682.85 g/mol. Its IUPAC name is 10-(3,5-diphenylphenyl)-6-(4,6-diphenyl-1,3,5-triazin-2-yl)-[1]benzothiolo[3,2-b]indole.
| Compound Name | 10-(3,5-diphenylphenyl)-6-(4,6-diphenyl-1,3,5-triazin-2-yl)-[1]benzothiolo[3,2-b]indole |
|---|---|
| PubChem CID | 90296146 |
| Molecular Formula | C47H30N4S |
| Molecular Weight | 682.85 g/mol |
| Exact Mass | 682.22 |
| IUPAC Name | 10-(3,5-diphenylphenyl)-6-(4,6-diphenyl-1,3,5-triazin-2-yl)-[1]benzothiolo[3,2-b]indole |
| SMILES | c1ccc(-c2cc(-c3ccccc3)cc(-n3c4ccccc4c4sc5c(-c6nc(-c7ccccc7)nc(-c7ccccc7)n6)cccc5c43)c2)cc1 |
| InChI | InChI=1S/C47H30N4S/c1-5-16-31(17-6-1)35-28-36(32-18-7-2-8-19-32)30-37(29-35)51-41-27-14-13-24-38(41)44-42(51)39-25-15-26-40(43(39)52-44)47-49-45(33-20-9-3-10-21-33)48-46(50-47)34-22-11-4-12-23-34/h1-30H |
| InChIKey | LWHGZDPQTWXHHY-UHFFFAOYSA-N |
| XLogP | 12.52 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.85 |
| LogP ≤ 5 | 12.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |