C39H24N4S — CID 90296154
6-(4,6-diphenyl-1,3,5-triazin-2-yl)-11-phenyl-3-thia-11-azapentacyclo[10.8.0.02,10.04,9.013,18]icosa-1(12),2(10),4(9),5,7,13,15,17,19-nonaene (PubChem CID 90296154) has the molecular formula C39H24N4S and a molecular weight of 580.72 g/mol. Its IUPAC name is 6-(4,6-diphenyl-1,3,5-triazin-2-yl)-11-phenyl-3-thia-11-azapentacyclo[10.8.0.02,10.04,9.013,18]icosa-1(12),2(10),4(9),5,7,13,15,17,19-nonaene.
| Compound Name | 6-(4,6-diphenyl-1,3,5-triazin-2-yl)-11-phenyl-3-thia-11-azapentacyclo[10.8.0.02,10.04,9.013,18]icosa-1(12),2(10),4(9),5,7,13,15,17,19-nonaene |
|---|---|
| PubChem CID | 90296154 |
| Molecular Formula | C39H24N4S |
| Molecular Weight | 580.72 g/mol |
| Exact Mass | 580.17 |
| IUPAC Name | 6-(4,6-diphenyl-1,3,5-triazin-2-yl)-11-phenyl-3-thia-11-azapentacyclo[10.8.0.02,10.04,9.013,18]icosa-1(12),2(10),4(9),5,7,13,15,17,19-nonaene |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc4c(c3)sc3c5ccc6ccccc6c5n(-c5ccccc5)c43)n2)cc1 |
| InChI | InChI=1S/C39H24N4S/c1-4-13-26(14-5-1)37-40-38(27-15-6-2-7-16-27)42-39(41-37)28-21-22-31-33(24-28)44-36-32-23-20-25-12-10-11-19-30(25)34(32)43(35(31)36)29-17-8-3-9-18-29/h1-24H |
| InChIKey | SZSVCSLPFLGINY-UHFFFAOYSA-N |
| XLogP | 10.34 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.72 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |