C35H22N4S — CID 90296170
12-(4,6-diphenylpyrimidin-2-yl)-8-phenyl-16-thia-4,8-diazatetracyclo[7.7.0.02,7.010,15]hexadeca-1(9),2(7),3,5,10(15),11,13-heptaene (PubChem CID 90296170) has the molecular formula C35H22N4S and a molecular weight of 530.66 g/mol. Its IUPAC name is 12-(4,6-diphenylpyrimidin-2-yl)-8-phenyl-16-thia-4,8-diazatetracyclo[7.7.0.02,7.010,15]hexadeca-1(9),2(7),3,5,10(15),11,13-heptaene.
| Compound Name | 12-(4,6-diphenylpyrimidin-2-yl)-8-phenyl-16-thia-4,8-diazatetracyclo[7.7.0.02,7.010,15]hexadeca-1(9),2(7),3,5,10(15),11,13-heptaene |
|---|---|
| PubChem CID | 90296170 |
| Molecular Formula | C35H22N4S |
| Molecular Weight | 530.66 g/mol |
| Exact Mass | 530.16 |
| IUPAC Name | 12-(4,6-diphenylpyrimidin-2-yl)-8-phenyl-16-thia-4,8-diazatetracyclo[7.7.0.02,7.010,15]hexadeca-1(9),2(7),3,5,10(15),11,13-heptaene |
| SMILES | c1ccc(-c2cc(-c3ccccc3)nc(-c3ccc4sc5c6cnccc6n(-c6ccccc6)c5c4c3)n2)cc1 |
| InChI | InChI=1S/C35H22N4S/c1-4-10-23(11-5-1)29-21-30(24-12-6-2-7-13-24)38-35(37-29)25-16-17-32-27(20-25)33-34(40-32)28-22-36-19-18-31(28)39(33)26-14-8-3-9-15-26/h1-22H |
| InChIKey | CLWGNHAGVIJVCJ-UHFFFAOYSA-N |
| XLogP | 9.18 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.66 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |