About 7-ethyl-5,6-dihydrocyclopenta[b]pyridin-7-ol
7-ethyl-5,6-dihydrocyclopenta[b]pyridin-7-ol (PubChem CID 90296462) has the molecular formula C10H13NO
and a molecular weight of 163.22 g/mol. Its IUPAC name is 7-ethyl-5,6-dihydrocyclopenta[b]pyridin-7-ol.
Molecular Properties
| Compound Name | 7-ethyl-5,6-dihydrocyclopenta[b]pyridin-7-ol |
| PubChem CID | 90296462 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 7-ethyl-5,6-dihydrocyclopenta[b]pyridin-7-ol |
| SMILES | CCC1(O)CCc2cccnc21 |
| InChI | InChI=1S/C10H13NO/c1-2-10(12)6-5-8-4-3-7-11-9(8)10/h3-4,7,12H,2,5-6H2,1H3 |
| InChIKey | QDHROTBJXWJNKG-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-ethyl-5,6-dihydrocyclopenta[b]pyridin-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethyl-5,6-dihydrocyclopenta[b]pyridin-7-ol?
The IUPAC name of 7-ethyl-5,6-dihydrocyclopenta[b]pyridin-7-ol (CID 90296462) is 7-ethyl-5,6-dihydrocyclopenta[b]pyridin-7-ol.
What is the SMILES notation for 7-ethyl-5,6-dihydrocyclopenta[b]pyridin-7-ol?
The canonical SMILES for 7-ethyl-5,6-dihydrocyclopenta[b]pyridin-7-ol is CCC1(O)CCc2cccnc21.
What is the InChIKey of 7-ethyl-5,6-dihydrocyclopenta[b]pyridin-7-ol?
The InChIKey is QDHROTBJXWJNKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO/c1-2-10(12)6-5-8-4-3-7-11-9(8)10/h3-4,7,12H,2,5-6H2,1H3.
What are the key properties of 7-ethyl-5,6-dihydrocyclopenta[b]pyridin-7-ol?
7-ethyl-5,6-dihydrocyclopenta[b]pyridin-7-ol has a molecular weight of 163.22 g/mol, XLogP of 1.63, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethyl-5,6-dihydrocyclopenta[b]pyridin-7-ol is sourced from PubChem (CID 90296462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).