C11H17N — CID 90296464
(8E)-8-ethylidene-4,4a,5,6,7,8a-hexahydro-3H-isoquinoline (PubChem CID 90296464) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is (8E)-8-ethylidene-4,4a,5,6,7,8a-hexahydro-3H-isoquinoline.
| Compound Name | (8E)-8-ethylidene-4,4a,5,6,7,8a-hexahydro-3H-isoquinoline |
|---|---|
| PubChem CID | 90296464 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | (8E)-8-ethylidene-4,4a,5,6,7,8a-hexahydro-3H-isoquinoline |
| SMILES | C/C=C1\CCCC2CCN=CC12 |
| InChI | InChI=1S/C11H17N/c1-2-9-4-3-5-10-6-7-12-8-11(9)10/h2,8,10-11H,3-7H2,1H3/b9-2+ |
| InChIKey | YPSLRBUUKQLCDJ-XNWCZRBMSA-N |
| XLogP | 2.82 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|