C16H28O7 — CID 90296487
3-[[3-methoxy-2,2-bis(methoxymethyl)propoxy]methyl]-3-(2-oxoethyl)pentanedial (PubChem CID 90296487) has the molecular formula C16H28O7 and a molecular weight of 332.39 g/mol. Its IUPAC name is 3-[[3-methoxy-2,2-bis(methoxymethyl)propoxy]methyl]-3-(2-oxoethyl)pentanedial.
| Compound Name | 3-[[3-methoxy-2,2-bis(methoxymethyl)propoxy]methyl]-3-(2-oxoethyl)pentanedial |
|---|---|
| PubChem CID | 90296487 |
| Molecular Formula | C16H28O7 |
| Molecular Weight | 332.39 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | 3-[[3-methoxy-2,2-bis(methoxymethyl)propoxy]methyl]-3-(2-oxoethyl)pentanedial |
| SMILES | COCC(COC)(COC)COCC(CC=O)(CC=O)CC=O |
| InChI | InChI=1S/C16H28O7/c1-20-10-16(11-21-2,12-22-3)14-23-13-15(4-7-17,5-8-18)6-9-19/h7-9H,4-6,10-14H2,1-3H3 |
| InChIKey | LWHGLOBBAVOISL-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.39 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|