About 5-carbamoyl-2-(3,6-diamino-9H-xanthen-9-yl)benzoic acid
5-carbamoyl-2-(3,6-diamino-9H-xanthen-9-yl)benzoic acid (PubChem CID 90296570) has the molecular formula C21H17N3O4
and a molecular weight of 375.38 g/mol. Its IUPAC name is 5-carbamoyl-2-(3,6-diamino-9H-xanthen-9-yl)benzoic acid.
Molecular Properties
| Compound Name | 5-carbamoyl-2-(3,6-diamino-9H-xanthen-9-yl)benzoic acid |
| PubChem CID | 90296570 |
| Molecular Formula | C21H17N3O4 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | 5-carbamoyl-2-(3,6-diamino-9H-xanthen-9-yl)benzoic acid |
| SMILES | NC(=O)c1ccc(C2c3ccc(N)cc3Oc3cc(N)ccc32)c(C(=O)O)c1 |
| InChI | InChI=1S/C21H17N3O4/c22-11-2-5-14-17(8-11)28-18-9-12(23)3-6-15(18)19(14)13-4-1-10(20(24)25)7-16(13)21(26)27/h1-9,19H,22-23H2,(H2,24,25)(H,26,27) |
| InChIKey | BULHMOBZYLOQKI-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 141.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-carbamoyl-2-(3,6-diamino-9H-xanthen-9-yl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-carbamoyl-2-(3,6-diamino-9H-xanthen-9-yl)benzoic acid?
The IUPAC name of 5-carbamoyl-2-(3,6-diamino-9H-xanthen-9-yl)benzoic acid (CID 90296570) is 5-carbamoyl-2-(3,6-diamino-9H-xanthen-9-yl)benzoic acid.
What is the SMILES notation for 5-carbamoyl-2-(3,6-diamino-9H-xanthen-9-yl)benzoic acid?
The canonical SMILES for 5-carbamoyl-2-(3,6-diamino-9H-xanthen-9-yl)benzoic acid is NC(=O)c1ccc(C2c3ccc(N)cc3Oc3cc(N)ccc32)c(C(=O)O)c1.
What is the InChIKey of 5-carbamoyl-2-(3,6-diamino-9H-xanthen-9-yl)benzoic acid?
The InChIKey is BULHMOBZYLOQKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17N3O4/c22-11-2-5-14-17(8-11)28-18-9-12(23)3-6-15(18)19(14)13-4-1-10(20(24)25)7-16(13)21(26)27/h1-9,19H,22-23H2,(H2,24,25)(H,26,27).
What are the key properties of 5-carbamoyl-2-(3,6-diamino-9H-xanthen-9-yl)benzoic acid?
5-carbamoyl-2-(3,6-diamino-9H-xanthen-9-yl)benzoic acid has a molecular weight of 375.38 g/mol, XLogP of 2.93, 3 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-carbamoyl-2-(3,6-diamino-9H-xanthen-9-yl)benzoic acid is sourced from PubChem (CID 90296570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).